C13H20Si — CID 14932605
[(Z)-dec-3-en-1,5-diynyl]-trimethylsilane (PubChem CID 14932605) has the molecular formula C13H20Si and a molecular weight of 204.39 g/mol. Its IUPAC name is [(Z)-dec-3-en-1,5-diynyl]-trimethylsilane.
| Compound Name | [(Z)-dec-3-en-1,5-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 14932605 |
| Molecular Formula | C13H20Si |
| Molecular Weight | 204.39 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | [(Z)-dec-3-en-1,5-diynyl]-trimethylsilane |
| SMILES | CCCCC#C/C=C\C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H20Si/c1-5-6-7-8-9-10-11-12-13-14(2,3)4/h10-11H,5-7H2,1-4H3/b11-10- |
| InChIKey | VTIVBLVHIXVZGD-KHPPLWFESA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|