About [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane
[(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane (PubChem CID 11010036) has the molecular formula C15H24Si
and a molecular weight of 232.44 g/mol. Its IUPAC name is [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
| PubChem CID | 11010036 |
| Molecular Formula | C15H24Si |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
| SMILES | C#C/C=C\C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H24Si/c1-8-9-10-11-12-16(13(2)3,14(4)5)15(6)7/h1,9-10,13-15H,2-7H3/b10-9- |
| InChIKey | AJIBTUUECNFRSM-KTKRTIGZSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane?
The IUPAC name of [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane (CID 11010036) is [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane.
What is the SMILES notation for [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane?
The canonical SMILES for [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane is C#C/C=C\C#C[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane?
The InChIKey is AJIBTUUECNFRSM-KTKRTIGZSA-N. The full InChI is InChI=1S/C15H24Si/c1-8-9-10-11-12-16(13(2)3,14(4)5)15(6)7/h1,9-10,13-15H,2-7H3/b10-9-.
What are the key properties of [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane?
[(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane has a molecular weight of 232.44 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane is sourced from PubChem (CID 11010036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).