C24H30N2O5 — CID 149334781
2-[(Z)-6-cyclohexyl-1-oxo-1-(phenylmethoxyamino)hex-3-en-3-yl]-5-methyl-1,3-oxazole-4-carboxylic acid (PubChem CID 149334781) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 2-[(Z)-6-cyclohexyl-1-oxo-1-(phenylmethoxyamino)hex-3-en-3-yl]-5-methyl-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[(Z)-6-cyclohexyl-1-oxo-1-(phenylmethoxyamino)hex-3-en-3-yl]-5-methyl-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 149334781 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-[(Z)-6-cyclohexyl-1-oxo-1-(phenylmethoxyamino)hex-3-en-3-yl]-5-methyl-1,3-oxazole-4-carboxylic acid |
| SMILES | Cc1oc(/C(=C\CCC2CCCCC2)CC(=O)NOCc2ccccc2)nc1C(=O)O |
| InChI | InChI=1S/C24H30N2O5/c1-17-22(24(28)29)25-23(31-17)20(14-8-13-18-9-4-2-5-10-18)15-21(27)26-30-16-19-11-6-3-7-12-19/h3,6-7,11-12,14,18H,2,4-5,8-10,13,15-16H2,1H3,(H,26,27)(H,28,29)/b20-14- |
| InChIKey | YDAGGWMEQHNGDW-ZHZULCJRSA-N |
| XLogP | 5.06 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|