C28H41N3O4 — CID 22733316
6-cyclohexyl-3-[5-methyl-4-(morpholin-4-ylmethyl)-1,3-oxazol-2-yl]-N-phenylmethoxyhexanamide (PubChem CID 22733316) has the molecular formula C28H41N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is 6-cyclohexyl-3-[5-methyl-4-(morpholin-4-ylmethyl)-1,3-oxazol-2-yl]-N-phenylmethoxyhexanamide.
| Compound Name | 6-cyclohexyl-3-[5-methyl-4-(morpholin-4-ylmethyl)-1,3-oxazol-2-yl]-N-phenylmethoxyhexanamide |
|---|---|
| PubChem CID | 22733316 |
| Molecular Formula | C28H41N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | 6-cyclohexyl-3-[5-methyl-4-(morpholin-4-ylmethyl)-1,3-oxazol-2-yl]-N-phenylmethoxyhexanamide |
| SMILES | Cc1oc(C(CCCC2CCCCC2)CC(=O)NOCc2ccccc2)nc1CN1CCOCC1 |
| InChI | InChI=1S/C28H41N3O4/c1-22-26(20-31-15-17-33-18-16-31)29-28(35-22)25(14-8-13-23-9-4-2-5-10-23)19-27(32)30-34-21-24-11-6-3-7-12-24/h3,6-7,11-12,23,25H,2,4-5,8-10,13-21H2,1H3,(H,30,32) |
| InChIKey | PJJNGSUXXDLNEA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|