C30H45N3O3 — CID 58860999
(3R)-6-cyclohexyl-3-[4-[(cyclohexylamino)methyl]-5-methyl-1,3-oxazol-2-yl]-N-phenylmethoxyhexanamide (PubChem CID 58860999) has the molecular formula C30H45N3O3 and a molecular weight of 495.71 g/mol. Its IUPAC name is (3R)-6-cyclohexyl-3-[4-[(cyclohexylamino)methyl]-5-methyl-1,3-oxazol-2-yl]-N-phenylmethoxyhexanamide.
| Compound Name | (3R)-6-cyclohexyl-3-[4-[(cyclohexylamino)methyl]-5-methyl-1,3-oxazol-2-yl]-N-phenylmethoxyhexanamide |
|---|---|
| PubChem CID | 58860999 |
| Molecular Formula | C30H45N3O3 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.35 |
| IUPAC Name | (3R)-6-cyclohexyl-3-[4-[(cyclohexylamino)methyl]-5-methyl-1,3-oxazol-2-yl]-N-phenylmethoxyhexanamide |
| SMILES | Cc1oc([C@H](CCCC2CCCCC2)CC(=O)NOCc2ccccc2)nc1CNC1CCCCC1 |
| InChI | InChI=1S/C30H45N3O3/c1-23-28(21-31-27-18-9-4-10-19-27)32-30(36-23)26(17-11-16-24-12-5-2-6-13-24)20-29(34)33-35-22-25-14-7-3-8-15-25/h3,7-8,14-15,24,26-27,31H,2,4-6,9-13,16-22H2,1H3,(H,33,34)/t26-/m1/s1 |
| InChIKey | WQNQCFQHLHALSK-AREMUKBSSA-N |
| XLogP | 6.88 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|