C36H55N3O8 — CID 158700912
(3R)-3-(4-acetyl-1,3-oxazol-2-yl)-6-cyclohexyl-N-ethoxyhexanamide;(3R)-3-(4-acetyl-1,3-oxazol-2-yl)-6-cyclohexylhexanoic acid (PubChem CID 158700912) has the molecular formula C36H55N3O8 and a molecular weight of 657.85 g/mol. Its IUPAC name is (3R)-3-(4-acetyl-1,3-oxazol-2-yl)-6-cyclohexyl-N-ethoxyhexanamide;(3R)-3-(4-acetyl-1,3-oxazol-2-yl)-6-cyclohexylhexanoic acid.
| Compound Name | (3R)-3-(4-acetyl-1,3-oxazol-2-yl)-6-cyclohexyl-N-ethoxyhexanamide;(3R)-3-(4-acetyl-1,3-oxazol-2-yl)-6-cyclohexylhexanoic acid |
|---|---|
| PubChem CID | 158700912 |
| Molecular Formula | C36H55N3O8 |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.40 |
| IUPAC Name | (3R)-3-(4-acetyl-1,3-oxazol-2-yl)-6-cyclohexyl-N-ethoxyhexanamide;(3R)-3-(4-acetyl-1,3-oxazol-2-yl)-6-cyclohexylhexanoic acid |
| SMILES | CC(=O)c1coc([C@H](CCCC2CCCCC2)CC(=O)O)n1.CCONC(=O)C[C@@H](CCCC1CCCCC1)c1nc(C(C)=O)co1 |
| InChI | InChI=1S/C19H30N2O4.C17H25NO4/c1-3-25-21-18(23)12-16(19-20-17(13-24-19)14(2)22)11-7-10-15-8-5-4-6-9-15;1-12(19)15-11-22-17(18-15)14(10-16(20)21)9-5-8-13-6-3-2-4-7-13/h13,15-16H,3-12H2,1-2H3,(H,21,23);11,13-14H,2-10H2,1H3,(H,20,21)/t16-;14-/m11/s1 |
| InChIKey | IHNMUHJOGRUIPM-ZONRDUKOSA-N |
| XLogP | 8.36 |
| TPSA | 161.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|