C10H11FN2O3S — CID 14934012
(4S)-4-benzyl-2-(fluoromethyl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 14934012) has the molecular formula C10H11FN2O3S and a molecular weight of 258.27 g/mol. Its IUPAC name is (4S)-4-benzyl-2-(fluoromethyl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | (4S)-4-benzyl-2-(fluoromethyl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 14934012 |
| Molecular Formula | C10H11FN2O3S |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (4S)-4-benzyl-2-(fluoromethyl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1[C@H](Cc2ccccc2)NS(=O)(=O)N1CF |
| InChI | InChI=1S/C10H11FN2O3S/c11-7-13-10(14)9(12-17(13,15)16)6-8-4-2-1-3-5-8/h1-5,9,12H,6-7H2/t9-/m0/s1 |
| InChIKey | RDPJSXIGTYEMGP-VIFPVBQESA-N |
| XLogP | 0.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|