C14H12N2O2 — CID 54671863
3-benzyl-2,3-dihydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 54671863) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-benzyl-2,3-dihydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 3-benzyl-2,3-dihydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 54671863 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-benzyl-2,3-dihydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1NC(Cc2ccccc2)C(=O)n2cccc21 |
| InChI | InChI=1S/C14H12N2O2/c17-13-12-7-4-8-16(12)14(18)11(15-13)9-10-5-2-1-3-6-10/h1-8,11H,9H2,(H,15,17) |
| InChIKey | ZNBKJUMIPBZJER-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |