About 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one
2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one (PubChem CID 70148576) has the molecular formula C23H20N2O2
and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one.
Molecular Properties
| Compound Name | 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one |
| PubChem CID | 70148576 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one |
| SMILES | O=C1C(Cc2ccccc2)NC(c2ccccc2)=C(c2ccccc2)N1O |
| InChI | InChI=1S/C23H20N2O2/c26-23-20(16-17-10-4-1-5-11-17)24-21(18-12-6-2-7-13-18)22(25(23)27)19-14-8-3-9-15-19/h1-15,20,24,27H,16H2 |
| InChIKey | MIWSZLUMHIWDPP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one?
The IUPAC name of 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one (CID 70148576) is 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one.
What is the SMILES notation for 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one?
The canonical SMILES for 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one is O=C1C(Cc2ccccc2)NC(c2ccccc2)=C(c2ccccc2)N1O.
What is the InChIKey of 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one?
The InChIKey is MIWSZLUMHIWDPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O2/c26-23-20(16-17-10-4-1-5-11-17)24-21(18-12-6-2-7-13-18)22(25(23)27)19-14-8-3-9-15-19/h1-15,20,24,27H,16H2.
What are the key properties of 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one?
2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one has a molecular weight of 356.43 g/mol, XLogP of 3.94, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-hydroxy-5,6-diphenyl-1,2-dihydropyrazin-3-one is sourced from PubChem (CID 70148576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).