C19H26N4O5 — CID 149356441
1,3-oxazol-2-yl-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]diazene (PubChem CID 149356441) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1,3-oxazol-2-yl-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]diazene.
| Compound Name | 1,3-oxazol-2-yl-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]diazene |
|---|---|
| PubChem CID | 149356441 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1,3-oxazol-2-yl-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]diazene |
| SMILES | c1coc(/N=N/c2ccc(N3CCOCCOCCOCCOCC3)cc2)n1 |
| InChI | InChI=1S/C19H26N4O5/c1-3-18(4-2-17(1)21-22-19-20-5-8-28-19)23-6-9-24-11-13-26-15-16-27-14-12-25-10-7-23/h1-5,8H,6-7,9-16H2/b22-21+ |
| InChIKey | YHAUHYSPZDSSFL-QURGRASLSA-N |
| XLogP | 2.98 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|