C18H25F6NO — CID 149357025
1-[2-[2-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyethyl]piperidine (PubChem CID 149357025) has the molecular formula C18H25F6NO and a molecular weight of 385.39 g/mol. Its IUPAC name is 1-[2-[2-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyethyl]piperidine.
| Compound Name | 1-[2-[2-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyethyl]piperidine |
|---|---|
| PubChem CID | 149357025 |
| Molecular Formula | C18H25F6NO |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[2-[2-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyethyl]piperidine |
| SMILES | CC1(C)C=CC(C(OCCN2CCCCC2)(C(F)(F)F)C(F)(F)F)=CC1 |
| InChI | InChI=1S/C18H25F6NO/c1-15(2)8-6-14(7-9-15)16(17(19,20)21,18(22,23)24)26-13-12-25-10-4-3-5-11-25/h6-8H,3-5,9-13H2,1-2H3 |
| InChIKey | YHDNYFQFVWGKEA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |