C17H13Cl2N7O2S — CID 149358037
2-[[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]methyl]-5-[(3-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazole (PubChem CID 149358037) has the molecular formula C17H13Cl2N7O2S and a molecular weight of 450.31 g/mol. Its IUPAC name is 2-[[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]methyl]-5-[(3-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazole.
| Compound Name | 2-[[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]methyl]-5-[(3-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 149358037 |
| Molecular Formula | C17H13Cl2N7O2S |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 2-[[1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]methyl]-5-[(3-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazole |
| SMILES | O=[N+]([O-])c1ccn(Cc2nnc(Cc3ccn(Cc4c(Cl)cccc4Cl)n3)s2)n1 |
| InChI | InChI=1S/C17H13Cl2N7O2S/c18-13-2-1-3-14(19)12(13)9-24-6-4-11(22-24)8-16-20-21-17(29-16)10-25-7-5-15(23-25)26(27)28/h1-7H,8-10H2 |
| InChIKey | YHISNEBILCONSO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|