C51H92N4O4 — CID 149358678
[(9Z,12Z)-octadeca-9,12-dienyl] 8-[4-[(dimethylamino)methyl]piperazin-1-yl]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-5-oxooctanoate (PubChem CID 149358678) has the molecular formula C51H92N4O4 and a molecular weight of 825.32 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] 8-[4-[(dimethylamino)methyl]piperazin-1-yl]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-5-oxooctanoate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] 8-[4-[(dimethylamino)methyl]piperazin-1-yl]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-5-oxooctanoate |
|---|---|
| PubChem CID | 149358678 |
| Molecular Formula | C51H92N4O4 |
| Molecular Weight | 825.32 g/mol |
| Exact Mass | 824.71 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] 8-[4-[(dimethylamino)methyl]piperazin-1-yl]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]-5-oxooctanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)C(CCC(=O)CCCN1CCN(CN(C)C)CC1)NC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C51H92N4O4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-46-59-51(58)49(40-39-48(56)37-36-41-54-42-44-55(45-43-54)47-53(3)4)52-50(57)38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,49H,5-12,17-18,23-47H2,1-4H3,(H,52,57)/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | YHMBULPOVPKGOX-KWXKLSQISA-N |
| XLogP | 11.91 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.32 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|