C17H14O5 — CID 149359660
1-[(7-oxofuro[3,2-g]chromen-5-yl)methyl]cyclobutane-1-carboxylic acid (PubChem CID 149359660) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is 1-[(7-oxofuro[3,2-g]chromen-5-yl)methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(7-oxofuro[3,2-g]chromen-5-yl)methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 149359660 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-[(7-oxofuro[3,2-g]chromen-5-yl)methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(Cc2cc(=O)oc3cc4occc4cc23)CCC1 |
| InChI | InChI=1S/C17H14O5/c18-15-7-11(9-17(16(19)20)3-1-4-17)12-6-10-2-5-21-13(10)8-14(12)22-15/h2,5-8H,1,3-4,9H2,(H,19,20) |
| InChIKey | YHQRLOYZKPJNQZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|