(2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate

C15H24O2 — CID 149369184

IUPAC(2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate
SMILESCC1C=C2CCC(C)(OC(=O)C(C)C)C(C2)C1
InChIInChI=1S/C15H24O2/c1-10(2)14(16)17-15(4)6-5-12-7-11(3)8-13(15)9-12/h7,10-11,13H,5-6,8-9H2,1-4H3
InChIKeyYJLVHEKCFRCQEM-UHFFFAOYSA-N
MW236.35 g/mol
LogP3.71
Rot. Bonds2

About (2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate

(2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate (PubChem CID 149369184) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate.

Molecular Properties

Compound Name(2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate
PubChem CID149369184
Molecular FormulaC15H24O2
Molecular Weight236.35 g/mol
Exact Mass236.18
IUPAC Name(2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate
SMILESCC1C=C2CCC(C)(OC(=O)C(C)C)C(C2)C1
InChIInChI=1S/C15H24O2/c1-10(2)14(16)17-15(4)6-5-12-7-11(3)8-13(15)9-12/h7,10-11,13H,5-6,8-9H2,1-4H3
InChIKeyYJLVHEKCFRCQEM-UHFFFAOYSA-N
XLogP3.71
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.35
LogP ≤ 53.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate?
The IUPAC name of (2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate (CID 149369184) is (2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate.
What is the SMILES notation for (2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate?
The canonical SMILES for (2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate is CC1C=C2CCC(C)(OC(=O)C(C)C)C(C2)C1.
What is the InChIKey of (2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate?
The InChIKey is YJLVHEKCFRCQEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-10(2)14(16)17-15(4)6-5-12-7-11(3)8-13(15)9-12/h7,10-11,13H,5-6,8-9H2,1-4H3.
What are the key properties of (2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate?
(2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate has a molecular weight of 236.35 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,7-dimethyl-2-bicyclo[3.3.1]non-5-enyl) 2-methylpropanoate is sourced from PubChem (CID 149369184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).