C15H21FN4 — CID 149395907
5-fluoro-N-[4-(methylaminomethyl)cyclohexyl]-7H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 149395907) has the molecular formula C15H21FN4 and a molecular weight of 276.36 g/mol. Its IUPAC name is 5-fluoro-N-[4-(methylaminomethyl)cyclohexyl]-7H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | 5-fluoro-N-[4-(methylaminomethyl)cyclohexyl]-7H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 149395907 |
| Molecular Formula | C15H21FN4 |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 5-fluoro-N-[4-(methylaminomethyl)cyclohexyl]-7H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CNCC1CCC(Nc2ncnc3c2C(F)=CC3)CC1 |
| InChI | InChI=1S/C15H21FN4/c1-17-8-10-2-4-11(5-3-10)20-15-14-12(16)6-7-13(14)18-9-19-15/h6,9-11,17H,2-5,7-8H2,1H3,(H,18,19,20) |
| InChIKey | YOLHAHGQSUHVEH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |