C18H26F5N3 — CID 22097428
N-(4-tert-butylcyclohexyl)-6-ethyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-amine (PubChem CID 22097428) has the molecular formula C18H26F5N3 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-6-ethyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-amine.
| Compound Name | N-(4-tert-butylcyclohexyl)-6-ethyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 22097428 |
| Molecular Formula | C18H26F5N3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-6-ethyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-amine |
| SMILES | CCc1ncnc(NC2CCC(C(C)(C)C)CC2)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H26F5N3/c1-5-13-14(17(19,20)18(21,22)23)15(25-10-24-13)26-12-8-6-11(7-9-12)16(2,3)4/h10-12H,5-9H2,1-4H3,(H,24,25,26) |
| InChIKey | GBZCVLCLKUARED-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|