C26H28Si2 — CID 14940711
trimethyl-[2-[16-(2-trimethylsilylethynyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaenyl]ethynyl]silane (PubChem CID 14940711) has the molecular formula C26H28Si2 and a molecular weight of 396.68 g/mol. Its IUPAC name is trimethyl-[2-[16-(2-trimethylsilylethynyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaenyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[16-(2-trimethylsilylethynyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaenyl]ethynyl]silane |
|---|---|
| PubChem CID | 14940711 |
| Molecular Formula | C26H28Si2 |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | trimethyl-[2-[16-(2-trimethylsilylethynyl)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13,15-heptaenyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#CC1=C(C#C[Si](C)(C)C)C2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C26H28Si2/c1-27(2,3)17-15-23-24(16-18-28(4,5)6)26-21-13-9-7-11-19(21)25(23)20-12-8-10-14-22(20)26/h7-14,25-26H,1-6H3 |
| InChIKey | SQCGHVCVUJDWHV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|