C22H28 — CID 601803
9,10-dibutyl-9,10-dihydroanthracene (PubChem CID 601803) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 9,10-dibutyl-9,10-dihydroanthracene.
| Compound Name | 9,10-dibutyl-9,10-dihydroanthracene |
|---|---|
| PubChem CID | 601803 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 9,10-dibutyl-9,10-dihydroanthracene |
| SMILES | CCCCC1c2ccccc2C(CCCC)c2ccccc21 |
| InChI | InChI=1S/C22H28/c1-3-5-11-17-19-13-7-9-15-21(19)18(12-6-4-2)22-16-10-8-14-20(17)22/h7-10,13-18H,3-6,11-12H2,1-2H3 |
| InChIKey | LIHYHPHHILCBKU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |