C7H13NO2S — CID 14941164
methyl 3-(1,3-thiazolidin-3-yl)propanoate (PubChem CID 14941164) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is methyl 3-(1,3-thiazolidin-3-yl)propanoate.
| Compound Name | methyl 3-(1,3-thiazolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 14941164 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | methyl 3-(1,3-thiazolidin-3-yl)propanoate |
| SMILES | COC(=O)CCN1CCSC1 |
| InChI | InChI=1S/C7H13NO2S/c1-10-7(9)2-3-8-4-5-11-6-8/h2-6H2,1H3 |
| InChIKey | VGTSEXYOCNFEPJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |