C11H12BrNS — CID 14941907
3-benzyl-5-methyl-1,3-thiazol-3-ium bromide (PubChem CID 14941907) has the molecular formula C11H12BrNS and a molecular weight of 270.19 g/mol. Its IUPAC name is 3-benzyl-5-methyl-1,3-thiazol-3-ium bromide.
| Compound Name | 3-benzyl-5-methyl-1,3-thiazol-3-ium bromide |
|---|---|
| PubChem CID | 14941907 |
| Molecular Formula | C11H12BrNS |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 3-benzyl-5-methyl-1,3-thiazol-3-ium bromide |
| SMILES | Cc1c[n+](Cc2ccccc2)cs1.[Br-] |
| InChI | InChI=1S/C11H12NS.BrH/c1-10-7-12(9-13-10)8-11-5-3-2-4-6-11;/h2-7,9H,8H2,1H3;1H/q+1;/p-1 |
| InChIKey | XMNKSIJJCMDHPD-UHFFFAOYSA-M |
| XLogP | -0.60 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|