C20H22ClNO5S — CID 149427386
cyclohexyl 5-[(5-chloro-2-methoxyphenyl)sulfonylmethyl]pyridine-3-carboxylate (PubChem CID 149427386) has the molecular formula C20H22ClNO5S and a molecular weight of 423.92 g/mol. Its IUPAC name is cyclohexyl 5-[(5-chloro-2-methoxyphenyl)sulfonylmethyl]pyridine-3-carboxylate.
| Compound Name | cyclohexyl 5-[(5-chloro-2-methoxyphenyl)sulfonylmethyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 149427386 |
| Molecular Formula | C20H22ClNO5S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | cyclohexyl 5-[(5-chloro-2-methoxyphenyl)sulfonylmethyl]pyridine-3-carboxylate |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)Cc1cncc(C(=O)OC2CCCCC2)c1 |
| InChI | InChI=1S/C20H22ClNO5S/c1-26-18-8-7-16(21)10-19(18)28(24,25)13-14-9-15(12-22-11-14)20(23)27-17-5-3-2-4-6-17/h7-12,17H,2-6,13H2,1H3 |
| InChIKey | YUJHBXRFOLWTCL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |