C20H21F3N2O6S — CID 71724734
cyclohexyl 5-[[2-methoxy-5-(trifluoromethoxy)phenyl]sulfonylamino]pyridine-3-carboxylate (PubChem CID 71724734) has the molecular formula C20H21F3N2O6S and a molecular weight of 474.46 g/mol. Its IUPAC name is cyclohexyl 5-[[2-methoxy-5-(trifluoromethoxy)phenyl]sulfonylamino]pyridine-3-carboxylate.
| Compound Name | cyclohexyl 5-[[2-methoxy-5-(trifluoromethoxy)phenyl]sulfonylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 71724734 |
| Molecular Formula | C20H21F3N2O6S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | cyclohexyl 5-[[2-methoxy-5-(trifluoromethoxy)phenyl]sulfonylamino]pyridine-3-carboxylate |
| SMILES | COc1ccc(OC(F)(F)F)cc1S(=O)(=O)Nc1cncc(C(=O)OC2CCCCC2)c1 |
| InChI | InChI=1S/C20H21F3N2O6S/c1-29-17-8-7-16(31-20(21,22)23)10-18(17)32(27,28)25-14-9-13(11-24-12-14)19(26)30-15-5-3-2-4-6-15/h7-12,15,25H,2-6H2,1H3 |
| InChIKey | FUHQIJAZPMLYCX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |