C27H27Cl2F5N4O4 — CID 149427462
2-[[2,6-dichloro-3-[[(2-methyloxolane-2-carbonyl)amino]methyl]phenyl]methyl]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide (PubChem CID 149427462) has the molecular formula C27H27Cl2F5N4O4 and a molecular weight of 637.43 g/mol. Its IUPAC name is 2-[[2,6-dichloro-3-[[(2-methyloxolane-2-carbonyl)amino]methyl]phenyl]methyl]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide.
| Compound Name | 2-[[2,6-dichloro-3-[[(2-methyloxolane-2-carbonyl)amino]methyl]phenyl]methyl]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 149427462 |
| Molecular Formula | C27H27Cl2F5N4O4 |
| Molecular Weight | 637.43 g/mol |
| Exact Mass | 636.13 |
| IUPAC Name | 2-[[2,6-dichloro-3-[[(2-methyloxolane-2-carbonyl)amino]methyl]phenyl]methyl]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide |
| SMILES | Cn1c(Cc2c(Cl)ccc(CNC(=O)C3(C)CCCO3)c2Cl)nc2cc(C(=O)NCC(F)(F)F)c(OCC(F)F)cc21 |
| InChI | InChI=1S/C27H27Cl2F5N4O4/c1-26(6-3-7-42-26)25(40)35-11-14-4-5-17(28)15(23(14)29)9-22-37-18-8-16(24(39)36-13-27(32,33)34)20(41-12-21(30)31)10-19(18)38(22)2/h4-5,8,10,21H,3,6-7,9,11-13H2,1-2H3,(H,35,40)(H,36,39) |
| InChIKey | YUJRRCGDHWNTCZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |