C29H25N3O5 — CID 1494298
N'-[2-hydroxy-2,2-bis(2-methylphenyl)acetyl]-4-nitro-N-phenylbenzohydrazide (PubChem CID 1494298) has the molecular formula C29H25N3O5 and a molecular weight of 495.54 g/mol. Its IUPAC name is N'-[2-hydroxy-2,2-bis(2-methylphenyl)acetyl]-4-nitro-N-phenylbenzohydrazide.
| Compound Name | N'-[2-hydroxy-2,2-bis(2-methylphenyl)acetyl]-4-nitro-N-phenylbenzohydrazide |
|---|---|
| PubChem CID | 1494298 |
| Molecular Formula | C29H25N3O5 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N'-[2-hydroxy-2,2-bis(2-methylphenyl)acetyl]-4-nitro-N-phenylbenzohydrazide |
| SMILES | Cc1ccccc1C(O)(C(=O)NN(C(=O)c1ccc([N+](=O)[O-])cc1)c1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C29H25N3O5/c1-20-10-6-8-14-25(20)29(35,26-15-9-7-11-21(26)2)28(34)30-31(23-12-4-3-5-13-23)27(33)22-16-18-24(19-17-22)32(36)37/h3-19,35H,1-2H3,(H,30,34) |
| InChIKey | BSXMDWNHRHDODJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|