C23H36O5 — CID 149435006
tricos-7-ene-2,5,15,18,21-pentone (PubChem CID 149435006) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is tricos-7-ene-2,5,15,18,21-pentone.
| Compound Name | tricos-7-ene-2,5,15,18,21-pentone |
|---|---|
| PubChem CID | 149435006 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | tricos-7-ene-2,5,15,18,21-pentone |
| SMILES | CCC(=O)CCC(=O)CCC(=O)CCCCCCC=CCC(=O)CCC(C)=O |
| InChI | InChI=1S/C23H36O5/c1-3-20(25)15-16-23(28)18-17-22(27)12-10-8-6-4-5-7-9-11-21(26)14-13-19(2)24/h7,9H,3-6,8,10-18H2,1-2H3 |
| InChIKey | YASDAMSCJQDYKJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|