C20H21Cl2NO6 — CID 149447168
2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-(15-methoxy-2,6,10-trioxabicyclo[9.4.0]pentadeca-1(15),11,13-trien-12-yl)ethanone (PubChem CID 149447168) has the molecular formula C20H21Cl2NO6 and a molecular weight of 442.30 g/mol. Its IUPAC name is 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-(15-methoxy-2,6,10-trioxabicyclo[9.4.0]pentadeca-1(15),11,13-trien-12-yl)ethanone.
| Compound Name | 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-(15-methoxy-2,6,10-trioxabicyclo[9.4.0]pentadeca-1(15),11,13-trien-12-yl)ethanone |
|---|---|
| PubChem CID | 149447168 |
| Molecular Formula | C20H21Cl2NO6 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-(15-methoxy-2,6,10-trioxabicyclo[9.4.0]pentadeca-1(15),11,13-trien-12-yl)ethanone |
| SMILES | COc1ccc(C(=O)Cc2c(Cl)c[n+]([O-])cc2Cl)c2c1OCCCOCCCO2 |
| InChI | InChI=1S/C20H21Cl2NO6/c1-26-18-5-4-13(17(24)10-14-15(21)11-23(25)12-16(14)22)19-20(18)29-9-3-7-27-6-2-8-28-19/h4-5,11-12H,2-3,6-10H2,1H3 |
| InChIKey | YWXHHYDUSRXOHE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|