C17H16Cl2N2O5 — CID 24957745
2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]acetamide (PubChem CID 24957745) has the molecular formula C17H16Cl2N2O5 and a molecular weight of 399.23 g/mol. Its IUPAC name is 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]acetamide.
| Compound Name | 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 24957745 |
| Molecular Formula | C17H16Cl2N2O5 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 2-[6-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2,3-dimethoxyphenoxy]acetamide |
| SMILES | COc1ccc(C(=O)Cc2c(Cl)cncc2Cl)c(OCC(N)=O)c1OC |
| InChI | InChI=1S/C17H16Cl2N2O5/c1-24-14-4-3-9(16(17(14)25-2)26-8-15(20)23)13(22)5-10-11(18)6-21-7-12(10)19/h3-4,6-7H,5,8H2,1-2H3,(H2,20,23) |
| InChIKey | HABXMRUXTIDQDY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |