C20H17ClF2N2O2 — CID 149470069
(3S)-1-(3-chloro-4-isocyanophenyl)-4-(5,6-difluoro-2,3-dihydroindol-1-yl)-3-hydroxy-3-methylbutan-2-one (PubChem CID 149470069) has the molecular formula C20H17ClF2N2O2 and a molecular weight of 390.82 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-isocyanophenyl)-4-(5,6-difluoro-2,3-dihydroindol-1-yl)-3-hydroxy-3-methylbutan-2-one.
| Compound Name | (3S)-1-(3-chloro-4-isocyanophenyl)-4-(5,6-difluoro-2,3-dihydroindol-1-yl)-3-hydroxy-3-methylbutan-2-one |
|---|---|
| PubChem CID | 149470069 |
| Molecular Formula | C20H17ClF2N2O2 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (3S)-1-(3-chloro-4-isocyanophenyl)-4-(5,6-difluoro-2,3-dihydroindol-1-yl)-3-hydroxy-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)CN2CCc3cc(F)c(F)cc32)cc1Cl |
| InChI | InChI=1S/C20H17ClF2N2O2/c1-20(27,19(26)8-12-3-4-17(24-2)14(21)7-12)11-25-6-5-13-9-15(22)16(23)10-18(13)25/h3-4,7,9-10,27H,5-6,8,11H2,1H3/t20-/m0/s1 |
| InChIKey | ZBEQPATUHTWEIF-FQEVSTJZSA-N |
| XLogP | 4.09 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|