C26H24BrNO3S — CID 149470413
amino 2-[4-[3-(5-bromo-2-phenylmethoxyphenyl)thiophen-2-yl]-6-methylcyclohexa-2,4-dien-1-yl]acetate (PubChem CID 149470413) has the molecular formula C26H24BrNO3S and a molecular weight of 510.45 g/mol. Its IUPAC name is amino 2-[4-[3-(5-bromo-2-phenylmethoxyphenyl)thiophen-2-yl]-6-methylcyclohexa-2,4-dien-1-yl]acetate.
| Compound Name | amino 2-[4-[3-(5-bromo-2-phenylmethoxyphenyl)thiophen-2-yl]-6-methylcyclohexa-2,4-dien-1-yl]acetate |
|---|---|
| PubChem CID | 149470413 |
| Molecular Formula | C26H24BrNO3S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | amino 2-[4-[3-(5-bromo-2-phenylmethoxyphenyl)thiophen-2-yl]-6-methylcyclohexa-2,4-dien-1-yl]acetate |
| SMILES | CC1C=C(c2sccc2-c2cc(Br)ccc2OCc2ccccc2)C=CC1CC(=O)ON |
| InChI | InChI=1S/C26H24BrNO3S/c1-17-13-20(8-7-19(17)14-25(29)31-28)26-22(11-12-32-26)23-15-21(27)9-10-24(23)30-16-18-5-3-2-4-6-18/h2-13,15,17,19H,14,16,28H2,1H3 |
| InChIKey | ZBGCQDZVPNNTKT-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|