C19H28N4O3S — CID 149482514
2-[[butylamino(hydroxy)methyl]amino]-N-[2-(2-hydroxyethyl)-6-methylphenyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 149482514) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-[[butylamino(hydroxy)methyl]amino]-N-[2-(2-hydroxyethyl)-6-methylphenyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[butylamino(hydroxy)methyl]amino]-N-[2-(2-hydroxyethyl)-6-methylphenyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 149482514 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-[[butylamino(hydroxy)methyl]amino]-N-[2-(2-hydroxyethyl)-6-methylphenyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCNC(O)Nc1nc(C)c(C(=O)Nc2c(C)cccc2CCO)s1 |
| InChI | InChI=1S/C19H28N4O3S/c1-4-5-10-20-18(26)23-19-21-13(3)16(27-19)17(25)22-15-12(2)7-6-8-14(15)9-11-24/h6-8,18,20,24,26H,4-5,9-11H2,1-3H3,(H,21,23)(H,22,25) |
| InChIKey | ZDNPFFZHARISAZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|