C21H25ClN6O3S2 — CID 87864761
2-(butylcarbamoylamino)-N-(2-chloro-6-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide;1,3-thiazole-5-carboxamide (PubChem CID 87864761) has the molecular formula C21H25ClN6O3S2 and a molecular weight of 509.06 g/mol. Its IUPAC name is 2-(butylcarbamoylamino)-N-(2-chloro-6-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide;1,3-thiazole-5-carboxamide.
| Compound Name | 2-(butylcarbamoylamino)-N-(2-chloro-6-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide;1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 87864761 |
| Molecular Formula | C21H25ClN6O3S2 |
| Molecular Weight | 509.06 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 2-(butylcarbamoylamino)-N-(2-chloro-6-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide;1,3-thiazole-5-carboxamide |
| SMILES | CCCCNC(=O)Nc1nc(C)c(C(=O)Nc2c(C)cccc2Cl)s1.NC(=O)c1cncs1 |
| InChI | InChI=1S/C17H21ClN4O2S.C4H4N2OS/c1-4-5-9-19-16(24)22-17-20-11(3)14(25-17)15(23)21-13-10(2)7-6-8-12(13)18;5-4(7)3-1-6-2-8-3/h6-8H,4-5,9H2,1-3H3,(H,21,23)(H2,19,20,22,24);1-2H,(H2,5,7) |
| InChIKey | GUGCLYISNHQUBI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.06 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|