C21H28N4O3S — CID 58719651
2-(butylcarbamoylamino)-N-[2,4-dimethyl-5-(2-oxopropyl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 58719651) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is 2-(butylcarbamoylamino)-N-[2,4-dimethyl-5-(2-oxopropyl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(butylcarbamoylamino)-N-[2,4-dimethyl-5-(2-oxopropyl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 58719651 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-(butylcarbamoylamino)-N-[2,4-dimethyl-5-(2-oxopropyl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCNC(=O)Nc1nc(C)c(C(=O)Nc2cc(CC(C)=O)c(C)cc2C)s1 |
| InChI | InChI=1S/C21H28N4O3S/c1-6-7-8-22-20(28)25-21-23-15(5)18(29-21)19(27)24-17-11-16(10-14(4)26)12(2)9-13(17)3/h9,11H,6-8,10H2,1-5H3,(H,24,27)(H2,22,23,25,28) |
| InChIKey | HIJWGHZKEYXENP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|