C20H28N4O2S — CID 18442027
2-(hexylcarbamoylamino)-4-(2,3,4-trimethylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 18442027) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-(hexylcarbamoylamino)-4-(2,3,4-trimethylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(hexylcarbamoylamino)-4-(2,3,4-trimethylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 18442027 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-(hexylcarbamoylamino)-4-(2,3,4-trimethylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCCCCNC(=O)Nc1nc(-c2ccc(C)c(C)c2C)c(C(N)=O)s1 |
| InChI | InChI=1S/C20H28N4O2S/c1-5-6-7-8-11-22-19(26)24-20-23-16(17(27-20)18(21)25)15-10-9-12(2)13(3)14(15)4/h9-10H,5-8,11H2,1-4H3,(H2,21,25)(H2,22,23,24,26) |
| InChIKey | XAHGQUMPTOWCGU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|