About (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid
(2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid (PubChem CID 149483108) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid.
Molecular Properties
| Compound Name | (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid |
| PubChem CID | 149483108 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid |
| SMILES | O=C(O)[C@H](O)C1=CC=CCC1 |
| InChI | InChI=1S/C8H10O3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-2,4,7,9H,3,5H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | ZDQLBXHJSIRLDP-SSDOTTSWSA-N |
| XLogP | 0.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid?
The IUPAC name of (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid (CID 149483108) is (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid.
What is the SMILES notation for (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid?
The canonical SMILES for (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid is O=C(O)[C@H](O)C1=CC=CCC1.
What is the InChIKey of (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid?
The InChIKey is ZDQLBXHJSIRLDP-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H10O3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-2,4,7,9H,3,5H2,(H,10,11)/t7-/m1/s1.
What are the key properties of (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid?
(2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid has a molecular weight of 154.16 g/mol, XLogP of 0.71, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-cyclohexa-1,3-dien-1-yl-2-hydroxyacetic acid is sourced from PubChem (CID 149483108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).