C8H9FO3 — CID 156646698
(3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid (PubChem CID 156646698) has the molecular formula C8H9FO3 and a molecular weight of 172.15 g/mol. Its IUPAC name is (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid.
| Compound Name | (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 156646698 |
| Molecular Formula | C8H9FO3 |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid |
| SMILES | C=C/C(=C\C(=C)F)C(O)C(=O)O |
| InChI | InChI=1S/C8H9FO3/c1-3-6(4-5(2)9)7(10)8(11)12/h3-4,7,10H,1-2H2,(H,11,12)/b6-4+ |
| InChIKey | YWDILXLVAODQPQ-GQCTYLIASA-N |
| XLogP | 1.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|