(3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid

C8H9FO3 — CID 156646698

IUPAC(3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid
SMILESC=C/C(=C\C(=C)F)C(O)C(=O)O
InChIInChI=1S/C8H9FO3/c1-3-6(4-5(2)9)7(10)8(11)12/h3-4,7,10H,1-2H2,(H,11,12)/b6-4+
InChIKeyYWDILXLVAODQPQ-GQCTYLIASA-N
MW172.15 g/mol
LogP1.03
Rot. Bonds4

About (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid

(3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid (PubChem CID 156646698) has the molecular formula C8H9FO3 and a molecular weight of 172.15 g/mol. Its IUPAC name is (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid.

Molecular Properties

Compound Name(3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid
PubChem CID156646698
Molecular FormulaC8H9FO3
Molecular Weight172.15 g/mol
Exact Mass172.05
IUPAC Name(3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid
SMILESC=C/C(=C\C(=C)F)C(O)C(=O)O
InChIInChI=1S/C8H9FO3/c1-3-6(4-5(2)9)7(10)8(11)12/h3-4,7,10H,1-2H2,(H,11,12)/b6-4+
InChIKeyYWDILXLVAODQPQ-GQCTYLIASA-N
XLogP1.03
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.15
LogP ≤ 51.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid?
The IUPAC name of (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid (CID 156646698) is (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid.
What is the SMILES notation for (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid?
The canonical SMILES for (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid is C=C/C(=C\C(=C)F)C(O)C(=O)O.
What is the InChIKey of (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid?
The InChIKey is YWDILXLVAODQPQ-GQCTYLIASA-N. The full InChI is InChI=1S/C8H9FO3/c1-3-6(4-5(2)9)7(10)8(11)12/h3-4,7,10H,1-2H2,(H,11,12)/b6-4+.
What are the key properties of (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid?
(3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid has a molecular weight of 172.15 g/mol, XLogP of 1.03, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-ethenyl-5-fluoro-2-hydroxyhexa-3,5-dienoic acid is sourced from PubChem (CID 156646698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).