C21H19NO5 — CID 149491100
methyl (E)-3-[9-[(2R)-4-hydroxy-5-(hydroxymethyl)-2,3-dihydrofuran-2-yl]carbazol-3-yl]prop-2-enoate (PubChem CID 149491100) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl (E)-3-[9-[(2R)-4-hydroxy-5-(hydroxymethyl)-2,3-dihydrofuran-2-yl]carbazol-3-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[9-[(2R)-4-hydroxy-5-(hydroxymethyl)-2,3-dihydrofuran-2-yl]carbazol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 149491100 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | methyl (E)-3-[9-[(2R)-4-hydroxy-5-(hydroxymethyl)-2,3-dihydrofuran-2-yl]carbazol-3-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)c1ccccc1n2[C@H]1CC(O)=C(CO)O1 |
| InChI | InChI=1S/C21H19NO5/c1-26-21(25)9-7-13-6-8-17-15(10-13)14-4-2-3-5-16(14)22(17)20-11-18(24)19(12-23)27-20/h2-10,20,23-24H,11-12H2,1H3/b9-7+/t20-/m1/s1 |
| InChIKey | ZFCIMYPOCVFPNA-FHVRUZERSA-N |
| XLogP | 3.66 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|