C29H33N3O3 — CID 141259042
methyl (E)-3-[1-(2-phenylacetyl)-5-(2-pyrrolidin-1-ylethyl)-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl]prop-2-enoate (PubChem CID 141259042) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is methyl (E)-3-[1-(2-phenylacetyl)-5-(2-pyrrolidin-1-ylethyl)-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-(2-phenylacetyl)-5-(2-pyrrolidin-1-ylethyl)-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl]prop-2-enoate |
|---|---|
| PubChem CID | 141259042 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | methyl (E)-3-[1-(2-phenylacetyl)-5-(2-pyrrolidin-1-ylethyl)-1,2,3,4-tetrahydropyrido[4,3-b]indol-8-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)c1c(n2CCN2CCCC2)CCNC1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H33N3O3/c1-35-27(34)12-10-22-9-11-24-23(19-22)28-25(32(24)18-17-31-15-5-6-16-31)13-14-30-29(28)26(33)20-21-7-3-2-4-8-21/h2-4,7-12,19,29-30H,5-6,13-18,20H2,1H3/b12-10+ |
| InChIKey | YWIGKXNRJDAJDF-ZRDIBKRKSA-N |
| XLogP | 3.92 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|