C11H14O6 — CID 14951859
(5-acetyl-1-methyl-4-oxo-3,8-dioxabicyclo[3.2.1]octan-6-yl) acetate (PubChem CID 14951859) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is (5-acetyl-1-methyl-4-oxo-3,8-dioxabicyclo[3.2.1]octan-6-yl) acetate.
| Compound Name | (5-acetyl-1-methyl-4-oxo-3,8-dioxabicyclo[3.2.1]octan-6-yl) acetate |
|---|---|
| PubChem CID | 14951859 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (5-acetyl-1-methyl-4-oxo-3,8-dioxabicyclo[3.2.1]octan-6-yl) acetate |
| SMILES | CC(=O)OC1CC2(C)COC(=O)C1(C(C)=O)O2 |
| InChI | InChI=1S/C11H14O6/c1-6(12)11-8(16-7(2)13)4-10(3,17-11)5-15-9(11)14/h8H,4-5H2,1-3H3 |
| InChIKey | PRJPWUDGDNUMNS-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|