About ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate
ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate (PubChem CID 14953040) has the molecular formula C23H28N2O3
and a molecular weight of 380.49 g/mol. Its IUPAC name is ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate |
| PubChem CID | 14953040 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)CC(C)(C)Cc1nc2ccccc2n1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-5-28-22(26)15-23(2,3)14-21-24-19-8-6-7-9-20(19)25(21)16-17-10-12-18(27-4)13-11-17/h6-13H,5,14-16H2,1-4H3 |
| InChIKey | MURNXXRNOPKLFG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate?
The IUPAC name of ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate (CID 14953040) is ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate.
What is the SMILES notation for ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate?
The canonical SMILES for ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate is CCOC(=O)CC(C)(C)Cc1nc2ccccc2n1Cc1ccc(OC)cc1.
What is the InChIKey of ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate?
The InChIKey is MURNXXRNOPKLFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O3/c1-5-28-22(26)15-23(2,3)14-21-24-19-8-6-7-9-20(19)25(21)16-17-10-12-18(27-4)13-11-17/h6-13H,5,14-16H2,1-4H3.
What are the key properties of ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate?
ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate has a molecular weight of 380.49 g/mol, XLogP of 4.62, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate is sourced from PubChem (CID 14953040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).