C18H14O — CID 14957844
1,1-dimethylaceanthrylen-2-one (PubChem CID 14957844) has the molecular formula C18H14O and a molecular weight of 246.31 g/mol. Its IUPAC name is 1,1-dimethylaceanthrylen-2-one.
| Compound Name | 1,1-dimethylaceanthrylen-2-one |
|---|---|
| PubChem CID | 14957844 |
| Molecular Formula | C18H14O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1,1-dimethylaceanthrylen-2-one |
| SMILES | CC1(C)C(=O)c2cccc3cc4ccccc4c1c23 |
| InChI | InChI=1S/C18H14O/c1-18(2)16-13-8-4-3-6-11(13)10-12-7-5-9-14(15(12)16)17(18)19/h3-10H,1-2H3 |
| InChIKey | AERZJLUGSIJIPZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|