About 2-bromoaceanthrylene
2-bromoaceanthrylene (PubChem CID 177460390) has the molecular formula C16H9Br
and a molecular weight of 281.15 g/mol. Its IUPAC name is 2-bromoaceanthrylene.
Molecular Properties
| Compound Name | 2-bromoaceanthrylene |
| PubChem CID | 177460390 |
| Molecular Formula | C16H9Br |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2-bromoaceanthrylene |
| SMILES | BrC1=Cc2c3ccccc3cc3cccc1c23 |
| InChI | InChI=1S/C16H9Br/c17-15-9-14-12-6-2-1-4-10(12)8-11-5-3-7-13(15)16(11)14/h1-9H |
| InChIKey | WSWFJDRLEQBLKH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoaceanthrylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoaceanthrylene?
The IUPAC name of 2-bromoaceanthrylene (CID 177460390) is 2-bromoaceanthrylene.
What is the SMILES notation for 2-bromoaceanthrylene?
The canonical SMILES for 2-bromoaceanthrylene is BrC1=Cc2c3ccccc3cc3cccc1c23.
What is the InChIKey of 2-bromoaceanthrylene?
The InChIKey is WSWFJDRLEQBLKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Br/c17-15-9-14-12-6-2-1-4-10(12)8-11-5-3-7-13(15)16(11)14/h1-9H.
What are the key properties of 2-bromoaceanthrylene?
2-bromoaceanthrylene has a molecular weight of 281.15 g/mol, XLogP of 5.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoaceanthrylene is sourced from PubChem (CID 177460390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).