C10H10ClNO2 — CID 14959502
[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol (PubChem CID 14959502) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol.
| Compound Name | [3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 14959502 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | [3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
| SMILES | OCC1CC(c2ccc(Cl)cc2)=NO1 |
| InChI | InChI=1S/C10H10ClNO2/c11-8-3-1-7(2-4-8)10-5-9(6-13)14-12-10/h1-4,9,13H,5-6H2 |
| InChIKey | FSRXLTYORJCHRR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |