C10H20OSi — CID 14961485
[(1R,4R)-1-methyl-4-trimethylsilylcyclopent-2-en-1-yl]methanol (PubChem CID 14961485) has the molecular formula C10H20OSi and a molecular weight of 184.35 g/mol. Its IUPAC name is [(1R,4R)-1-methyl-4-trimethylsilylcyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4R)-1-methyl-4-trimethylsilylcyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 14961485 |
| Molecular Formula | C10H20OSi |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | [(1R,4R)-1-methyl-4-trimethylsilylcyclopent-2-en-1-yl]methanol |
| SMILES | C[C@]1(CO)C=C[C@H]([Si](C)(C)C)C1 |
| InChI | InChI=1S/C10H20OSi/c1-10(8-11)6-5-9(7-10)12(2,3)4/h5-6,9,11H,7-8H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | RXWDTDZEPCFEDV-UWVGGRQHSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|