C11H24O2Si — CID 101008229
2-methyl-2-[(E)-4-trimethylsilylbut-2-enyl]propane-1,3-diol (PubChem CID 101008229) has the molecular formula C11H24O2Si and a molecular weight of 216.40 g/mol. Its IUPAC name is 2-methyl-2-[(E)-4-trimethylsilylbut-2-enyl]propane-1,3-diol.
| Compound Name | 2-methyl-2-[(E)-4-trimethylsilylbut-2-enyl]propane-1,3-diol |
|---|---|
| PubChem CID | 101008229 |
| Molecular Formula | C11H24O2Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-methyl-2-[(E)-4-trimethylsilylbut-2-enyl]propane-1,3-diol |
| SMILES | CC(CO)(CO)C/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C11H24O2Si/c1-11(9-12,10-13)7-5-6-8-14(2,3)4/h5-6,12-13H,7-10H2,1-4H3/b6-5+ |
| InChIKey | WWYYVEXYIGGVJG-AATRIKPKSA-N |
| XLogP | 2.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|