C27H29NO2 — CID 14965643
(2S,3S)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol (PubChem CID 14965643) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is (2S,3S)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol.
| Compound Name | (2S,3S)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol |
|---|---|
| PubChem CID | 14965643 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (2S,3S)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol |
| SMILES | C=C=C(OC)[C@@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H29NO2/c1-3-26(30-2)27(29)25(19-22-13-7-4-8-14-22)28(20-23-15-9-5-10-16-23)21-24-17-11-6-12-18-24/h4-18,25,27,29H,1,19-21H2,2H3/t25-,27-/m0/s1 |
| InChIKey | GYZDTPDYRIGYBK-BDYUSTAISA-N |
| XLogP | 4.98 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|