C13H18ClN — CID 14969231
5-chloro-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 14969231) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is 5-chloro-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 5-chloro-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 14969231 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 5-chloro-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCNC1CCc2c(Cl)cccc2C1 |
| InChI | InChI=1S/C13H18ClN/c1-2-8-15-11-6-7-12-10(9-11)4-3-5-13(12)14/h3-5,11,15H,2,6-9H2,1H3 |
| InChIKey | HFRGZLDPZNUNPM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |