C17H26O2 — CID 14977112
1-(3-methoxyphenyl)-3,7-dimethyloct-6-en-1-ol (PubChem CID 14977112) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3,7-dimethyloct-6-en-1-ol.
| Compound Name | 1-(3-methoxyphenyl)-3,7-dimethyloct-6-en-1-ol |
|---|---|
| PubChem CID | 14977112 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-(3-methoxyphenyl)-3,7-dimethyloct-6-en-1-ol |
| SMILES | COc1cccc(C(O)CC(C)CCC=C(C)C)c1 |
| InChI | InChI=1S/C17H26O2/c1-13(2)7-5-8-14(3)11-17(18)15-9-6-10-16(12-15)19-4/h6-7,9-10,12,14,17-18H,5,8,11H2,1-4H3 |
| InChIKey | MWQXGJHGZNMODY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|