C12H12N4O2S — CID 1498076
3,4-dimethyl-N-[(3-nitrophenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 1498076) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(3-nitrophenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 3,4-dimethyl-N-[(3-nitrophenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 1498076 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3,4-dimethyl-N-[(3-nitrophenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | Cc1csc(=NN=Cc2cccc([N+](=O)[O-])c2)n1C |
| InChI | InChI=1S/C12H12N4O2S/c1-9-8-19-12(15(9)2)14-13-7-10-4-3-5-11(6-10)16(17)18/h3-8H,1-2H3 |
| InChIKey | YBLLNSPMBRTTHF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|