C20H24N4O3S2 — CID 14981590
methyl (1Z)-N-(4-acetamidophenyl)sulfonyl-4-phenylpiperazine-1-carboximidothioate (PubChem CID 14981590) has the molecular formula C20H24N4O3S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is methyl (1Z)-N-(4-acetamidophenyl)sulfonyl-4-phenylpiperazine-1-carboximidothioate.
| Compound Name | methyl (1Z)-N-(4-acetamidophenyl)sulfonyl-4-phenylpiperazine-1-carboximidothioate |
|---|---|
| PubChem CID | 14981590 |
| Molecular Formula | C20H24N4O3S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | methyl (1Z)-N-(4-acetamidophenyl)sulfonyl-4-phenylpiperazine-1-carboximidothioate |
| SMILES | CS/C(=N\S(=O)(=O)c1ccc(NC(C)=O)cc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N4O3S2/c1-16(25)21-17-8-10-19(11-9-17)29(26,27)22-20(28-2)24-14-12-23(13-15-24)18-6-4-3-5-7-18/h3-11H,12-15H2,1-2H3,(H,21,25)/b22-20- |
| InChIKey | ZMGMFZVCCNUXJK-XDOYNYLZSA-N |
| XLogP | 2.87 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|